Structure of PDB 5s5l Chain C Binding Site BS01 |
|
|
Ligand ID | X0M |
InChI | InChI=1S/C11H14N2O/c1-8(14)13-10-6-9-4-2-3-5-11(9)12-7-10/h2-5,10,12H,6-7H2,1H3,(H,13,14)/t10-/m0/s1 |
InChIKey | HCEIEGOMGWEGOJ-JTQLQIEISA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CC(=O)NC1Cc2ccccc2NC1 | CACTVS 3.385 | CC(=O)N[C@@H]1CNc2ccccc2C1 | ACDLabs 12.01 | c2c1CC(CNc1ccc2)NC(C)=O | CACTVS 3.385 | CC(=O)N[CH]1CNc2ccccc2C1 | OpenEye OEToolkits 2.0.7 | CC(=O)N[C@H]1Cc2ccccc2NC1 |
|
Formula | C11 H14 N2 O |
Name | N-[(3S)-1,2,3,4-tetrahydroquinolin-3-yl]acetamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000019274805
|
PDB chain | 5s5l Chain B Residue 505
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|