Structure of PDB 5is0 Chain C Binding Site BS01 |
|
|
Ligand ID | 6ET |
InChI | InChI=1S/C19H21ClN2O2S/c20-16-5-3-13(4-6-16)7-8-21-19(25)22-9-1-2-14-10-17(23)18(24)11-15(14)12-22/h3-6,10-11,23-24H,1-2,7-9,12H2,(H,21,25) |
InChIKey | DRCMAZOSEIMCHM-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.4 | c1cc(ccc1CCNC(=S)N2CCCc3cc(c(cc3C2)O)O)Cl | CACTVS 3.385 | Oc1cc2CCCN(Cc2cc1O)C(=S)NCCc3ccc(Cl)cc3 | ACDLabs 12.01 | c12cc(c(O)cc1CCCN(C2)C(=S)NCCc3ccc(cc3)Cl)O |
|
Formula | C19 H21 Cl N2 O2 S |
Name | capsazepine; N-[2-(4-chlorophenyl)ethyl]-7,8-dihydroxy-1,3,4,5-tetrahydro-2H-2-benzazepine-2-carbothioamide |
ChEMBL | CHEMBL391997 |
DrugBank | |
ZINC | ZINC000003871859
|
PDB chain | 5is0 Chain C Residue 801
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|