Structure of PDB 5hkb Chain C Binding Site BS01 |
|
|
Ligand ID | 64L |
InChI | InChI=1S/C18H17Br2NO5/c1-9(2)12-7-11(3-4-15(12)22)26-18-13(19)5-10(6-14(18)20)21-16(23)8-17(24)25/h3-7,9,22H,8H2,1-2H3,(H,21,23)(H,24,25) |
InChIKey | VPCSYAVXDAUHLT-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.4 | CC(C)c1cc(ccc1O)Oc2c(cc(cc2Br)NC(=O)CC(=O)O)Br | ACDLabs 12.01 | C(=O)(O)CC(=O)Nc1cc(Br)c(c(c1)Br)Oc2ccc(c(c2)C(C)C)O | CACTVS 3.385 | CC(C)c1cc(Oc2c(Br)cc(NC(=O)CC(O)=O)cc2Br)ccc1O |
|
Formula | C18 H17 Br2 N O5 |
Name | KB2115; 3-({3,5-dibromo-4-[4-hydroxy-3-(propan-2-yl)phenoxy]phenyl}amino)-3-oxopropanoic acid |
ChEMBL | CHEMBL2035874 |
DrugBank | DB05035 |
ZINC | ZINC000001494227
|
PDB chain | 5hkb Chain C Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|