Structure of PDB 5brx Chain C Binding Site BS01 |
|
|
Ligand ID | TI4 |
InChI | InChI=1S/C14H18N2/c1-2-12(7-15-3-1)14-13-5-10-4-11(6-13)9-16(14)8-10/h1-3,7,10-11,13-14H,4-6,8-9H2/t10-,11+,13-,14-/m0/s1 |
InChIKey | INDYXBQOPZTSTJ-XCCSTKFXSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | C1[CH]2CC3C[CH]1CN(C2)[CH]3c4cccnc4 | CACTVS 3.385 | C1[C@@H]2CC3C[C@H]1CN(C2)[C@H]3c4cccnc4 | ACDLabs 12.01 | c1cc(cnc1)C2N3CC4CC2CC(C3)C4 | OpenEye OEToolkits 1.9.2 | c1cc(cnc1)C2C3CC4CC(C3)CN2C4 | OpenEye OEToolkits 1.9.2 | c1cc(cnc1)[C@H]2C3C[C@H]4C[C@@H](C3)CN2C4 |
|
Formula | C14 H18 N2 |
Name | (2R,3S,5R,7S)-2-(pyridin-3-yl)-1-azatricyclo[3.3.1.1~3,7~]decane |
ChEMBL | |
DrugBank | |
ZINC | ZINC000263620559
|
PDB chain | 5brx Chain D Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|