Structure of PDB 4yz9 Chain C Binding Site BS01 |
|
|
Ligand ID | 4K7 |
InChI | InChI=1S/C24H29Cl2N3O/c1-18-3-5-19(6-4-18)14-27-23(30)29-11-2-9-24(17-29)10-12-28(16-24)15-20-7-8-21(25)22(26)13-20/h3-8,13H,2,9-12,14-17H2,1H3,(H,27,30)/t24-/m1/s1 |
InChIKey | YFDASBFQKMHSSJ-XMMPIXPASA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Cc1ccc(CNC(=O)N2CCC[C]3(CCN(Cc4ccc(Cl)c(Cl)c4)C3)C2)cc1 | OpenEye OEToolkits 1.9.2 | Cc1ccc(cc1)CNC(=O)N2CCCC3(C2)CCN(C3)Cc4ccc(c(c4)Cl)Cl | ACDLabs 12.01 | c1cc(ccc1C)CNC(=O)N4CCCC2(CCN(C2)Cc3ccc(c(c3)Cl)Cl)C4 | CACTVS 3.385 | Cc1ccc(CNC(=O)N2CCC[C@]3(CCN(Cc4ccc(Cl)c(Cl)c4)C3)C2)cc1 | OpenEye OEToolkits 1.9.2 | Cc1ccc(cc1)CNC(=O)N2CCC[C@@]3(C2)CCN(C3)Cc4ccc(c(c4)Cl)Cl |
|
Formula | C24 H29 Cl2 N3 O |
Name | (5R)-2-(3,4-dichlorobenzyl)-N-(4-methylbenzyl)-2,7-diazaspiro[4.5]decane-7-carboxamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000210920309
|
PDB chain | 4yz9 Chain C Residue 1001
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|