Structure of PDB 4y73 Chain C Binding Site BS01 |
|
|
Ligand ID | XPY |
InChI | InChI=1S/C18H21F3N8O/c1-28-9-13(15(27-28)18(19,20)21)25-17(30)10-8-23-29-7-6-14(26-16(10)29)24-12-5-3-2-4-11(12)22/h6-9,11-12H,2-5,22H2,1H3,(H,24,26)(H,25,30)/t11-,12+/m0/s1 |
InChIKey | LAXFSYWLDNVHAQ-NWDGAFQWSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | Cn1cc(c(n1)C(F)(F)F)NC(=O)c2cnn3c2nc(cc3)N[C@@H]4CCCC[C@@H]4N | CACTVS 3.385 | Cn1cc(NC(=O)c2cnn3ccc(N[C@@H]4CCCC[C@@H]4N)nc23)c(n1)C(F)(F)F | OpenEye OEToolkits 1.9.2 | Cn1cc(c(n1)C(F)(F)F)NC(=O)c2cnn3c2nc(cc3)NC4CCCCC4N | ACDLabs 12.01 | FC(F)(F)c1nn(cc1NC(=O)c2c3nc(ccn3nc2)NC4CCCCC4N)C | CACTVS 3.385 | Cn1cc(NC(=O)c2cnn3ccc(N[CH]4CCCC[CH]4N)nc23)c(n1)C(F)(F)F |
|
Formula | C18 H21 F3 N8 O |
Name | 5-{[(1R,2S)-2-aminocyclohexyl]amino}-N-[1-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]pyrazolo[1,5-a]pyrimidine-3-carboxamide |
ChEMBL | CHEMBL3590478 |
DrugBank | |
ZINC | ZINC000263620686
|
PDB chain | 4y73 Chain C Residue 1000
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|