Structure of PDB 4xg8 Chain C Binding Site BS01 |
|
|
Ligand ID | X8G |
InChI | InChI=1S/C20H21ClN8O/c1-12-13(8-28-10-15(30)11-28)9-29(25-12)18-5-6-22-20(24-18)23-14-3-4-17-16(7-14)19(21)26-27(17)2/h3-7,9,15,30H,8,10-11H2,1-2H3,(H,22,23,24) |
InChIKey | UCXIKENKSBLXSM-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | Cc1c(cn(n1)c2ccnc(n2)Nc3ccc4c(c3)c(nn4C)Cl)CN5CC(C5)O | CACTVS 3.385 | Cn1nc(Cl)c2cc(Nc3nccc(n3)n4cc(CN5CC(O)C5)c(C)n4)ccc12 | ACDLabs 12.01 | Clc5nn(c1c5cc(cc1)Nc2nccc(n2)n3nc(c(c3)CN4CC(O)C4)C)C |
|
Formula | C20 H21 Cl N8 O |
Name | 1-[(1-{2-[(3-chloro-1-methyl-1H-indazol-5-yl)amino]pyrimidin-4-yl}-3-methyl-1H-pyrazol-4-yl)methyl]azetidin-3-ol |
ChEMBL | CHEMBL3622961 |
DrugBank | |
ZINC | ZINC000169709014
|
PDB chain | 4xg8 Chain C Residue 700
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
N499 D512 |
Catalytic site (residue number reindexed from 1) |
N129 D142 |
Enzyme Commision number |
2.7.10.2: non-specific protein-tyrosine kinase. |
|
|
|