Structure of PDB 4w9i Chain C Binding Site BS01 |
|
|
Ligand ID | 3JS |
InChI | InChI=1S/C23H28N4O5S/c1-13-21(33-12-25-13)16-5-3-15(4-6-16)9-24-22(31)19-7-17(29)11-27(19)23(32)20-8-18(30)10-26(20)14(2)28/h3-6,12,17-20,29-30H,7-11H2,1-2H3,(H,24,31)/t17-,18-,19+,20+/m1/s1 |
InChIKey | CCBNFSALFGXMHG-ZRNYENFQSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | Cc1c(scn1)c2ccc(cc2)CNC(=O)C3CC(CN3C(=O)C4CC(CN4C(=O)C)O)O | CACTVS 3.385 | CC(=O)N1C[C@H](O)C[C@H]1C(=O)N2C[C@H](O)C[C@H]2C(=O)NCc3ccc(cc3)c4scnc4C | OpenEye OEToolkits 1.9.2 | Cc1c(scn1)c2ccc(cc2)CNC(=O)[C@@H]3C[C@H](CN3C(=O)[C@@H]4C[C@H](CN4C(=O)C)O)O | CACTVS 3.385 | CC(=O)N1C[CH](O)C[CH]1C(=O)N2C[CH](O)C[CH]2C(=O)NCc3ccc(cc3)c4scnc4C | ACDLabs 12.01 | O=C(N1CC(O)CC1C(=O)N2CC(O)CC2C(=O)NCc4ccc(c3scnc3C)cc4)C |
|
Formula | C23 H28 N4 O5 S |
Name | (4R)-1-acetyl-4-hydroxy-L-prolyl-(4R)-4-hydroxy-N-[4-(4-methyl-1,3-thiazol-5-yl)benzyl]-L-prolinamide |
ChEMBL | CHEMBL3344085 |
DrugBank | |
ZINC | ZINC000098208453
|
PDB chain | 4w9i Chain C Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|