Structure of PDB 4q0n Chain C Binding Site BS01 |
|
|
Ligand ID | 2XD |
InChI | InChI=1S/C15H15N3O2/c19-14-4-2-1-3-12(14)15(20)6-8-18-7-5-11-9-16-17-13(11)10-18/h1-4,6,8-9,19H,5,7,10H2,(H,16,17)/b8-6+ |
InChIKey | JCKBNTULKLTRHY-SOFGYWHQSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Oc1ccccc1C(=O)C=CN2CCc3c[nH]nc3C2 | OpenEye OEToolkits 1.7.6 | c1ccc(c(c1)C(=O)/C=C/N2CCc3c[nH]nc3C2)O | CACTVS 3.385 | Oc1ccccc1C(=O)/C=C/N2CCc3c[nH]nc3C2 | ACDLabs 12.01 | O=C(c1ccccc1O)\C=C\N3CCc2cnnc2C3 | OpenEye OEToolkits 1.7.6 | c1ccc(c(c1)C(=O)C=CN2CCc3c[nH]nc3C2)O |
|
Formula | C15 H15 N3 O2 |
Name | (2E)-1-(2-hydroxyphenyl)-3-(2,4,5,7-tetrahydro-6H-pyrazolo[3,4-c]pyridin-6-yl)prop-2-en-1-one |
ChEMBL | CHEMBL3817933 |
DrugBank | |
ZINC | ZINC000098208347
|
PDB chain | 4q0n Chain C Residue 802
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|