Structure of PDB 4pcs Chain C Binding Site BS01 |
|
|
Ligand ID | 2M7 |
InChI | InChI=1S/C13H15NO2/c1-9-12(15)13(16)11(14-9)8-7-10-5-3-2-4-6-10/h2-6,9,11-16H,1H3/t9-,11-,12+,13-/m0/s1 |
InChIKey | RPIQJUPODSDSQH-SYEHKZFSSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | CC1C(C(C(N1)C#Cc2ccccc2)O)O | OpenEye OEToolkits 1.9.2 | C[C@H]1[C@H]([C@H]([C@@H](N1)C#Cc2ccccc2)O)O | CACTVS 3.385 | C[CH]1N[CH](C#Cc2ccccc2)[CH](O)[CH]1O | ACDLabs 12.01 | C(#Cc1ccccc1)C2NC(C)C(O)C2O | CACTVS 3.385 | C[C@@H]1N[C@@H](C#Cc2ccccc2)[C@H](O)[C@@H]1O |
|
Formula | C13 H15 N O2 |
Name | (2S,3R,4S,5S)-2-methyl-5-(phenylethynyl)pyrrolidine-3,4-diol |
ChEMBL | |
DrugBank | |
ZINC | ZINC000098208207
|
PDB chain | 4pcs Chain C Residue 503
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|