Structure of PDB 4mo5 Chain C Binding Site BS01 |
|
|
Ligand ID | AH0 |
InChI | InChI=1S/C11H17NO7/c1-4(10(15)16)18-9-7(12-5(2)13)11-17-3-6(19-11)8(9)14/h4,6-9,11,14H,3H2,1-2H3,(H,12,13)(H,15,16)/t4-,6-,7-,8-,9-,11-/m1/s1 |
InChIKey | ZFEGYUMHFZOYIY-YVNCZSHWSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | C[CH](O[CH]1[CH](O)[CH]2CO[CH](O2)[CH]1NC(C)=O)C(O)=O | CACTVS 3.341 | C[C@@H](O[C@H]1[C@H](O)[C@H]2CO[C@H](O2)[C@@H]1NC(C)=O)C(O)=O | OpenEye OEToolkits 1.5.0 | CC(C(=O)O)OC1C(C2OCC(C1O)O2)NC(=O)C | OpenEye OEToolkits 1.5.0 | C[C@H](C(=O)O)O[C@@H]1[C@H]([C@@H]2OC[C@H]([C@H]1O)O2)NC(=O)C | ACDLabs 10.04 | O=C(O)C(OC2C(O)C1OC(OC1)C2NC(=O)C)C |
|
Formula | C11 H17 N O7 |
Name | 2-(2-ACETYLAMINO-4-HYDROXY-6,8-DIOXA-BICYCLO[3.2.1]OCT-3-YLOXY)-PROPIONIC ACID; 1,6-anhydro-N-acetylmuramic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000034118661
|
PDB chain | 4mo5 Chain C Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.7.1.170: anhydro-N-acetylmuramic acid kinase. |
|
|
|