Structure of PDB 4lcc Chain C Binding Site BS01 |
|
|
Ligand ID | 1XL |
InChI | InChI=1S/C12H16N4O7/c17-3-5-1-16(2-6(19)9(21)7(20)4-18)10-8(13-5)11(22)15-12(23)14-10/h1,6-7,9,17-21H,2-4H2,(H,15,22,23)/t6-,7-,9+/m1/s1 |
InChIKey | RTNMDIMJQSRAGT-BHNWBGBOSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | OC[CH](O)[CH](O)[CH](O)CN1C=C(CO)N=C2C(=O)NC(=O)N=C12 | ACDLabs 12.01 | O=C1C2=NC(=CN(C2=NC(=O)N1)CC(O)C(O)C(O)CO)CO | OpenEye OEToolkits 1.7.6 | C1=C(N=C2C(=O)NC(=O)N=C2N1CC(C(C(CO)O)O)O)CO | OpenEye OEToolkits 1.7.6 | C1=C(N=C2C(=O)NC(=O)N=C2N1C[C@H]([C@@H]([C@@H](CO)O)O)O)CO | CACTVS 3.385 | OC[C@@H](O)[C@@H](O)[C@H](O)CN1C=C(CO)N=C2C(=O)NC(=O)N=C12 |
|
Formula | C12 H16 N4 O7 |
Name | 1-deoxy-1-[6-(hydroxymethyl)-2,4-dioxo-3,4-dihydropteridin-8(2H)-yl]-D-arabinitol |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095920632
|
PDB chain | 4lcc Chain C Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
Biological Process |
GO:0002474 |
antigen processing and presentation of peptide antigen via MHC class I |
GO:0002503 |
peptide antigen assembly with MHC class II protein complex |
GO:0006955 |
immune response |
GO:0019886 |
antigen processing and presentation of exogenous peptide antigen via MHC class II |
GO:0050778 |
positive regulation of immune response |
GO:0050870 |
positive regulation of T cell activation |
|
|