Structure of PDB 4kbk Chain C Binding Site BS01 |
|
|
Ligand ID | 1QG |
InChI | InChI=1S/C19H19FN4O/c1-24-11-16(19(23-24)13-2-4-15(20)5-3-13)14-6-7-21-17(10-14)18-12-25-9-8-22-18/h2-7,10-11,18,22H,8-9,12H2,1H3/t18-/m1/s1 |
InChIKey | ZVSNVLKUNCNJEG-GOSISDBHSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | Cn1cc(c2ccnc(c2)[C@H]3COCCN3)c(n1)c4ccc(F)cc4 | OpenEye OEToolkits 1.7.6 | Cn1cc(c(n1)c2ccc(cc2)F)c3ccnc(c3)C4COCCN4 | ACDLabs 12.01 | Fc1ccc(cc1)c2nn(cc2c3cc(ncc3)C4NCCOC4)C | OpenEye OEToolkits 1.7.6 | Cn1cc(c(n1)c2ccc(cc2)F)c3ccnc(c3)[C@H]4COCCN4 | CACTVS 3.370 | Cn1cc(c2ccnc(c2)[CH]3COCCN3)c(n1)c4ccc(F)cc4 |
|
Formula | C19 H19 F N4 O |
Name | (3S)-3-{4-[3-(4-fluorophenyl)-1-methyl-1H-pyrazol-4-yl]pyridin-2-yl}morpholine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095921279
|
PDB chain | 4kbk Chain C Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
D128 K130 |
Catalytic site (residue number reindexed from 1) |
D122 K124 |
Enzyme Commision number |
2.7.11.1: non-specific serine/threonine protein kinase. 2.7.11.26: [tau protein] kinase. |
|
|
|