Structure of PDB 4jit Chain C Binding Site BS01 |
|
|
Ligand ID | 3ZF |
InChI | InChI=1S/C11H15N6O5P/c12-11-14-9-8(10(19)15-11)13-5-17(9)6-1-2-16(3-6)7(18)4-23(20,21)22/h5-6H,1-4H2,(H2,20,21,22)(H3,12,14,15,19)/t6-/m0/s1 |
InChIKey | DPSMTUGMQGDYNX-LURJTMIESA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(N3CCC(n2cnc1c2N=C(N)NC1=O)C3)CP(=O)(O)O | CACTVS 3.385 | NC1=Nc2n(cnc2C(=O)N1)[CH]3CCN(C3)C(=O)C[P](O)(O)=O | OpenEye OEToolkits 1.7.6 | c1nc2c(n1[C@H]3CCN(C3)C(=O)CP(=O)(O)O)N=C(NC2=O)N | CACTVS 3.385 | NC1=Nc2n(cnc2C(=O)N1)[C@H]3CCN(C3)C(=O)C[P](O)(O)=O | OpenEye OEToolkits 1.7.6 | c1nc2c(n1C3CCN(C3)C(=O)CP(=O)(O)O)N=C(NC2=O)N |
|
Formula | C11 H15 N6 O5 P |
Name | {2-[(3S)-3-(2-amino-6-oxo-1,6-dihydro-9H-purin-9-yl)pyrrolidin-1-yl]-2-oxoethyl}phosphonic acid |
ChEMBL | CHEMBL2420976 |
DrugBank | |
ZINC | ZINC000096913400
|
PDB chain | 4jit Chain C Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.4.2.- 2.4.2.22: xanthine phosphoribosyltransferase. |
|
|
|