Structure of PDB 4jda Chain C Binding Site BS01 |
|
|
Ligand ID | A9S |
InChI | InChI=1S/C15H20O4/c1-10(7-13(17)18)5-6-15(19)11(2)8-12(16)9-14(15,3)4/h5-8,19H,9H2,1-4H3,(H,17,18)/b6-5+,10-7-/t15-/m0/s1 |
InChIKey | JLIDBLDQVAYHNE-QHFMCZIYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CC1=CC(=O)CC([C@@]1(/C=C/C(=C\C(=O)O)/C)O)(C)C | ACDLabs 12.01 | O=C(O)\C=C(/C=C/C1(O)C(=CC(=O)CC1(C)C)C)C | OpenEye OEToolkits 1.7.6 | CC1=CC(=O)CC(C1(C=CC(=CC(=O)O)C)O)(C)C | CACTVS 3.370 | CC(C=C[C]1(O)C(=CC(=O)CC1(C)C)C)=CC(O)=O | CACTVS 3.370 | CC(/C=C/[C@]1(O)C(=CC(=O)CC1(C)C)C)=C/C(O)=O |
|
Formula | C15 H20 O4 |
Name | (2Z,4E)-5-[(1R)-1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000004492869
|
PDB chain | 4jda Chain C Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|