Structure of PDB 4frr Chain C Binding Site BS01 |
|
|
Ligand ID | 0VC |
InChI | InChI=1S/C15H22N2O2/c1-18-5-3-11-7-15(11)12-6-14(9-16-8-12)19-10-13-2-4-17-13/h6,8-9,11,13,15,17H,2-5,7,10H2,1H3/t11-,13-,15-/m0/s1 |
InChIKey | NMIIKXFGCKOYRV-WHOFXGATSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | COCC[C@H]1C[C@@H]1c2cc(cnc2)OC[C@@H]3CCN3 | CACTVS 3.370 | COCC[C@H]1C[C@@H]1c2cncc(OC[C@@H]3CCN3)c2 | OpenEye OEToolkits 1.7.6 | COCCC1CC1c2cc(cnc2)OCC3CCN3 | ACDLabs 12.01 | n2cc(OCC1NCC1)cc(c2)C3CC3CCOC | CACTVS 3.370 | COCC[CH]1C[CH]1c2cncc(OC[CH]3CCN3)c2 |
|
Formula | C15 H22 N2 O2 |
Name | 3-[(2S)-azetidin-2-ylmethoxy]-5-[(1S,2R)-2-(2-methoxyethyl)cyclopropyl]pyridine |
ChEMBL | CHEMBL2024094 |
DrugBank | |
ZINC | ZINC000068203257
|
PDB chain | 4frr Chain C Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|