Structure of PDB 4f9b Chain C Binding Site BS01 |
|
|
Ligand ID | 0SY |
InChI | InChI=1S/C12H11N3O/c16-12-9-7-11(8-1-4-13-5-2-8)15-10(9)3-6-14-12/h1-2,4-5,7,15H,3,6H2,(H,14,16) |
InChIKey | DKXHSOUZPMHNIZ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C2c1cc(nc1CCN2)c3ccncc3 | CACTVS 3.370 | O=C1NCCc2[nH]c(cc12)c3ccncc3 | OpenEye OEToolkits 1.7.6 | c1cnccc1c2cc3c([nH]2)CCNC3=O |
|
Formula | C12 H11 N3 O |
Name | 2-(pyridin-4-yl)-1,5,6,7-tetrahydro-4H-pyrrolo[3,2-c]pyridin-4-one |
ChEMBL | CHEMBL225519 |
DrugBank | DB17043 |
ZINC | ZINC000016052718
|
PDB chain | 4f9b Chain C Residue 601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|