Structure of PDB 4cq6 Chain C Binding Site BS01 |
|
|
Ligand ID | T25 |
InChI | InChI=1S/C18H32O3/c1-2-3-10-13-16-17(21-16)14-11-8-6-4-5-7-9-12-15-18(19)20/h8,11,16-17H,2-7,9-10,12-15H2,1H3,(H,19,20)/b11-8-/t16-,17+/m0/s1 |
InChIKey | CCPPLLJZDQAOHD-BEBBCNLGSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 10.04 | O=C(O)CCCCCCC/C=C\CC1OC1CCCCC | CACTVS 3.341 | CCCCC[C@@H]1O[C@@H]1C\C=C/CCCCCCCC(O)=O | CACTVS 3.341 | CCCCC[CH]1O[CH]1CC=CCCCCCCCC(O)=O | OpenEye OEToolkits 1.5.0 | CCCCCC1C(O1)CC=CCCCCCCCC(=O)O | OpenEye OEToolkits 1.5.0 | CCCCC[C@H]1[C@H](O1)C\C=C/CCCCCCCC(=O)O |
|
Formula | C18 H32 O3 |
Name | (9Z)-11-[(2R,3S)-3-pentyloxiran-2-yl]undec-9-enoic acid; 12R,13S-epoxy-9(Z)-octadecenoic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000004097549
|
PDB chain | 4cq6 Chain C Residue 1189
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
5.3.99.6: allene-oxide cyclase. |
|
|
|