Structure of PDB 4caf Chain C Binding Site BS01 |
|
|
Ligand ID | 370 |
InChI | InChI=1S/C21H23N5O2S/c1-12-16(13(2)24-23-12)11-18-25-26-21(28-18)20-19(27-14-7-9-22-10-8-14)15-5-3-4-6-17(15)29-20/h3-6,14,22H,7-11H2,1-2H3,(H,23,24) |
InChIKey | BSFSQCSQIOYTCL-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | n1nc(c(c1C)Cc2nnc(o2)c5sc3ccccc3c5OC4CCNCC4)C | CACTVS 3.385 | Cc1[nH]nc(C)c1Cc2oc(nn2)c3sc4ccccc4c3OC5CCNCC5 | OpenEye OEToolkits 1.7.6 | Cc1c(c(n[nH]1)C)Cc2nnc(o2)c3c(c4ccccc4s3)OC5CCNCC5 |
|
Formula | C21 H23 N5 O2 S |
Name | 4-[(2-{5-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-1,3,4-oxadiazol-2-yl}-1-benzothiophen-3-yl)oxy]piperidine |
ChEMBL | CHEMBL3237436 |
DrugBank | |
ZINC | ZINC000098208399
|
PDB chain | 4caf Chain C Residue 1411
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|