Structure of PDB 4bks Chain C Binding Site BS01 |
|
|
Ligand ID | X6C |
InChI | InChI=1S/C17H19N3O4/c1-11(21)20-9-14(22)6-15(20)17(23)19-7-12-2-4-13(5-3-12)16-8-18-10-24-16/h2-5,8,10,14-15,22H,6-7,9H2,1H3,(H,19,23)/t14-,15+/m1/s1 |
InChIKey | KFYARNZFJDIZMC-CABCVRRESA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC(=O)N1C[C@H](O)C[C@H]1C(=O)NCc2ccc(cc2)c3ocnc3 | OpenEye OEToolkits 1.9.2 | CC(=O)N1CC(CC1C(=O)NCc2ccc(cc2)c3cnco3)O | OpenEye OEToolkits 1.9.2 | CC(=O)N1C[C@@H](C[C@H]1C(=O)NCc2ccc(cc2)c3cnco3)O | ACDLabs 12.01 | O=C(N1CC(O)CC1C(=O)NCc3ccc(c2ocnc2)cc3)C | CACTVS 3.385 | CC(=O)N1C[CH](O)C[CH]1C(=O)NCc2ccc(cc2)c3ocnc3 |
|
Formula | C17 H19 N3 O4 |
Name | (2S,4R)-1-ethanoyl-N-[[4-(1,3-oxazol-5-yl)phenyl]methyl]-4-oxidanyl-pyrrolidine-2-carboxamide |
ChEMBL | CHEMBL3108878 |
DrugBank | |
ZINC | ZINC000095920951
|
PDB chain | 4bks Chain C Residue 1203
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|