Structure of PDB 4b9k Chain C Binding Site BS01 |
|
|
Ligand ID | TG0 |
InChI | InChI=1S/C24H26N4O3S/c1-14-19(4-3-5-20(14)25)24(31)28-12-18(29)10-21(28)23(30)26-11-16-6-8-17(9-7-16)22-15(2)27-13-32-22/h3-9,13,18,21,29H,10-12,25H2,1-2H3,(H,26,30)/t18-,21+/m1/s1 |
InChIKey | AFUSGLDYQSDIEU-NQIIRXRSSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Cc1ncsc1c2ccc(CNC(=O)[CH]3C[CH](O)CN3C(=O)c4cccc(N)c4C)cc2 | OpenEye OEToolkits 1.9.2 | Cc1c(cccc1N)C(=O)N2CC(CC2C(=O)NCc3ccc(cc3)c4c(ncs4)C)O | ACDLabs 12.01 | O=C(c1cccc(N)c1C)N2CC(O)CC2C(=O)NCc4ccc(c3scnc3C)cc4 | OpenEye OEToolkits 1.9.2 | Cc1c(cccc1N)C(=O)N2C[C@@H](C[C@H]2C(=O)NCc3ccc(cc3)c4c(ncs4)C)O | CACTVS 3.385 | Cc1ncsc1c2ccc(CNC(=O)[C@@H]3C[C@@H](O)CN3C(=O)c4cccc(N)c4C)cc2 |
|
Formula | C24 H26 N4 O3 S |
Name | (2S,4R)-1-(3-amino-2-methylbenzoyl)-4-hydroxy-N-(4-(4-methylthiazol-5-yl)benzyl)pyrrolidine-2-carboxamide |
ChEMBL | CHEMBL3260851 |
DrugBank | |
ZINC | ZINC000098209448
|
PDB chain | 4b9k Chain C Residue 1203
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|