Structure of PDB 4b4g Chain C Binding Site BS01 |
|
|
Ligand ID | KKT |
InChI | InChI=1S/C16H22N4O4S/c1-3-4-10-25(23,24)19(2)13-14(17)20(16(22)18-15(13)21)11-12-8-6-5-7-9-12/h5-9H,3-4,10-11,17H2,1-2H3,(H,18,21,22) |
InChIKey | ILRSJTONHWLJFH-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | CCCCS(=O)(=O)N(C)C1=C(N(C(=O)NC1=O)Cc2ccccc2)N | CACTVS 3.385 | CCCC[S](=O)(=O)N(C)C1=C(N)N(Cc2ccccc2)C(=O)NC1=O | ACDLabs 12.01 | O=S(=O)(N(C1=C(N)N(C(=O)NC1=O)Cc2ccccc2)C)CCCC |
|
Formula | C16 H22 N4 O4 S |
Name | N-(6-amino-1-benzyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidin-5-yl)-N-methylbutane-1-sulfonamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095921227
|
PDB chain | 4b4g Chain C Residue 400
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.7.7.24: glucose-1-phosphate thymidylyltransferase. |
|
|
|