Structure of PDB 3vgw Chain C Binding Site BS01 |
|
|
Ligand ID | NVZ |
InChI | InChI=1S/C12H18N2O4S/c1-7(15)14-8-6-19-9(11(8)13-12(14)18)4-2-3-5-10(16)17/h8-9,11H,2-6H2,1H3,(H,13,18)(H,16,17)/t8-,9-,11-/m0/s1 |
InChIKey | LXKFOEIWWHPOIN-QXEWZRGKSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.2 | CC(=O)N1[C@H]2CS[C@H]([C@H]2NC1=O)CCCCC(=O)O | OpenEye OEToolkits 1.7.2 | CC(=O)N1C2CSC(C2NC1=O)CCCCC(=O)O | CACTVS 3.370 | CC(=O)N1[C@H]2CS[C@@H](CCCCC(O)=O)[C@H]2NC1=O | CACTVS 3.370 | CC(=O)N1[CH]2CS[CH](CCCCC(O)=O)[CH]2NC1=O | ACDLabs 12.01 | O=C(O)CCCCC1SCC2N(C(=O)C)C(=O)NC12 |
|
Formula | C12 H18 N2 O4 S |
Name | 5-[(3aS,4S,6aR)-1-acetyl-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl]pentanoic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095920950
|
PDB chain | 3vgw Chain C Residue 1124
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|