Structure of PDB 3t70 Chain C Binding Site BS01 |
|
|
Ligand ID | DU4 |
InChI | InChI=1S/C23H25N3O4/c1-25(22(16-8-4-2-5-9-16)17-10-6-3-7-11-17)15-19-18(27)14-21(30-19)26-13-12-20(28)24-23(26)29/h2-13,18-19,21-22,27H,14-15H2,1H3,(H,24,28,29)/t18-,19+,21+/m0/s1 |
InChIKey | GMULPQZINUAVEX-QKNQBKEWSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CN(C[CH]1O[CH](C[CH]1O)N2C=CC(=O)NC2=O)C(c3ccccc3)c4ccccc4 | ACDLabs 12.01 | O=C1NC(=O)N(C=C1)C2OC(C(O)C2)CN(C(c3ccccc3)c4ccccc4)C | OpenEye OEToolkits 1.7.2 | C[N@](C[C@@H]1[C@H](C[C@@H](O1)N2C=CC(=O)NC2=O)O)C(c3ccccc3)c4ccccc4 | CACTVS 3.370 | CN(C[C@H]1O[C@H](C[C@@H]1O)N2C=CC(=O)NC2=O)C(c3ccccc3)c4ccccc4 | OpenEye OEToolkits 1.7.2 | CN(CC1C(CC(O1)N2C=CC(=O)NC2=O)O)C(c3ccccc3)c4ccccc4 |
|
Formula | C23 H25 N3 O4 |
Name | 2',5'-dideoxy-5'-[(diphenylmethyl)(methyl)amino]uridine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095920595
|
PDB chain | 3t70 Chain C Residue 400
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|