Structure of PDB 3q8h Chain C Binding Site BS01 |
|
|
Ligand ID | AO9 |
InChI | InChI=1S/C15H16N6O5S/c16-9-1-2-21(14(25)19-9)13-11(23)10(22)8(26-13)6-17-12(24)7-5-18-15-20(7)3-4-27-15/h1-5,8,10-11,13,22-23H,6H2,(H,17,24)(H2,16,19,25)/t8-,10-,11-,13-/m1/s1 |
InChIKey | NPCKGXDYODQBDY-UORFTKCHSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | NC1=NC(=O)N(C=C1)[C@@H]2O[C@H](CNC(=O)c3cnc4sccn34)[C@@H](O)[C@H]2O | ACDLabs 12.01 | O=C1N=C(N)C=CN1C2OC(C(O)C2O)CNC(=O)c3cnc4sccn34 | OpenEye OEToolkits 1.7.0 | c1csc2n1c(cn2)C(=O)NCC3C(C(C(O3)N4C=CC(=NC4=O)N)O)O | CACTVS 3.370 | NC1=NC(=O)N(C=C1)[CH]2O[CH](CNC(=O)c3cnc4sccn34)[CH](O)[CH]2O | OpenEye OEToolkits 1.7.0 | c1csc2n1c(cn2)C(=O)NC[C@@H]3[C@H]([C@H]([C@@H](O3)N4C=CC(=NC4=O)N)O)O |
|
Formula | C15 H16 N6 O5 S |
Name | 5'-deoxy-5'-[(imidazo[2,1-b][1,3]thiazol-5-ylcarbonyl)amino]cytidine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000064746500
|
PDB chain | 3q8h Chain A Residue 164
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
4.6.1.12: 2-C-methyl-D-erythritol 2,4-cyclodiphosphate synthase. |
|
|
|