Structure of PDB 3oe8 Chain C Binding Site BS01 |
|
|
Ligand ID | ITD |
InChI | InChI=1S/C21H34N4S2/c1-21(2)15-25-18(14-27-20(25)24-21)13-26-19(22-16-9-5-3-6-10-16)23-17-11-7-4-8-12-17/h14,16-17H,3-13,15H2,1-2H3,(H,22,23) |
InChIKey | OOSUDWRRWZVFEB-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | CC1(CN2C(=CSC2=N1)CSC(=NC3CCCCC3)NC4CCCCC4)C | OpenEye OEToolkits 1.7.0 | CC1(CN2C(=CSC2=N1)CS/C(=N\C3CCCCC3)/NC4CCCCC4)C | ACDLabs 12.01 | N2=C1SC=C(N1CC2(C)C)CS\C(=N/C3CCCCC3)NC4CCCCC4 | CACTVS 3.370 | CC1(C)CN2C(=CSC2=N1)CSC(NC3CCCCC3)=NC4CCCCC4 |
|
Formula | C21 H34 N4 S2 |
Name | (6,6-dimethyl-5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-yl)methyl N,N'-dicyclohexylimidothiocarbamate |
ChEMBL | CHEMBL460491 |
DrugBank | |
ZINC | ZINC000049844830
|
PDB chain | 3oe8 Chain C Residue 1500
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
E1011 D1020 |
Catalytic site (residue number reindexed from 1) |
E200 D209 |
Enzyme Commision number |
3.2.1.17: lysozyme. |
|
|
|