Structure of PDB 3ndm Chain C Binding Site BS01 |
|
|
Ligand ID | 3ND |
InChI | InChI=1S/C20H17Cl2N3O2/c21-13-3-1-11(2-4-13)15-9-23-10-16(15)20(27)25-18-7-12-5-6-24-19(26)14(12)8-17(18)22/h1-4,6-8,15-16,23H,5,9-10H2,(H,25,27)/t15-,16+/m0/s1 |
InChIKey | WWMMSIAGRVSGLG-JKSUJKDBSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | c1cc(ccc1C2CNCC2C(=O)Nc3cc4c(cc3Cl)C(=O)N=CC4)Cl | ACDLabs 12.01 | O=C(Nc2cc1c(C(=O)N=CC1)cc2Cl)C4C(c3ccc(Cl)cc3)CNC4 | OpenEye OEToolkits 1.7.0 | c1cc(ccc1[C@@H]2CNC[C@H]2C(=O)Nc3cc4c(cc3Cl)C(=O)N=CC4)Cl | CACTVS 3.370 | Clc1ccc(cc1)[CH]2CNC[CH]2C(=O)Nc3cc4CC=NC(=O)c4cc3Cl | CACTVS 3.370 | Clc1ccc(cc1)[C@@H]2CNC[C@H]2C(=O)Nc3cc4CC=NC(=O)c4cc3Cl |
|
Formula | C20 H17 Cl2 N3 O2 |
Name | (3S,4R)-N-(7-chloro-1-oxo-1,4-dihydroisoquinolin-6-yl)-4-(4-chlorophenyl)pyrrolidine-3-carboxamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000058638587
|
PDB chain | 3ndm Chain C Residue 900
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|