Structure of PDB 3ncz Chain C Binding Site BS01 |
|
|
Ligand ID | 3NC |
InChI | InChI=1S/C16H18ClN3O2/c17-13-8-12-10(5-6-19-16(12)22)7-14(13)20-15(21)9-1-3-11(18)4-2-9/h5-9,11H,1-4,18H2,(H,19,22)(H,20,21)/t9-,11+ |
InChIKey | WHXKGHDWNQPZNP-JGZJWPJOSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | N[C@H]1CC[C@H](CC1)C(=O)Nc2cc3C=CNC(=O)c3cc2Cl | CACTVS 3.370 | N[CH]1CC[CH](CC1)C(=O)Nc2cc3C=CNC(=O)c3cc2Cl | ACDLabs 12.01 | O=C(Nc2c(Cl)cc1c(C=CNC1=O)c2)C3CCC(N)CC3 | OpenEye OEToolkits 1.7.0 | c1c2c(cc(c1NC(=O)C3CCC(CC3)N)Cl)C(=O)NC=C2 |
|
Formula | C16 H18 Cl N3 O2 |
Name | cis-4-amino-N-(7-chloro-1-oxo-1,2-dihydroisoquinolin-6-yl)cyclohexanecarboxamide |
ChEMBL | CHEMBL1222571 |
DrugBank | |
ZINC | ZINC000101362723
|
PDB chain | 3ncz Chain C Residue 900
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|