Structure of PDB 3mmx Chain C Binding Site BS01 |
|
|
Ligand ID | KJZ |
InChI | InChI=1S/C23H20ClN3O4/c24-19-10-3-4-11-20(19)26-21(28)12-13-22(29)27(15-23(30)31)25-14-17-8-5-7-16-6-1-2-9-18(16)17/h1-11,14H,12-13,15H2,(H,26,28)(H,30,31)/b25-14+ |
InChIKey | HHHUDHYQFQBYIZ-AFUMVMLFSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | OC(=O)CN(\N=C\c1cccc2ccccc12)C(=O)CCC(=O)Nc3ccccc3Cl | ACDLabs 12.01 | Clc3ccccc3NC(=O)CCC(=O)N(/N=C/c2c1ccccc1ccc2)CC(=O)O | OpenEye OEToolkits 1.7.0 | c1ccc2c(c1)cccc2/C=N/N(CC(=O)O)C(=O)CCC(=O)Nc3ccccc3Cl | CACTVS 3.370 | OC(=O)CN(N=Cc1cccc2ccccc12)C(=O)CCC(=O)Nc3ccccc3Cl | OpenEye OEToolkits 1.7.0 | c1ccc2c(c1)cccc2C=NN(CC(=O)O)C(=O)CCC(=O)Nc3ccccc3Cl |
|
Formula | C23 H20 Cl N3 O4 |
Name | [(2E)-1-{4-[(2-chlorophenyl)amino]-4-oxobutanoyl}-2-(naphthalen-1-ylmethylidene)hydrazino]acetic acid |
ChEMBL | CHEMBL1084868 |
DrugBank | |
ZINC | ZINC000049045725
|
PDB chain | 3mmx Chain B Residue 191
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.7.7.18: nicotinate-nucleotide adenylyltransferase. |
|
|
|