Structure of PDB 3fuc Chain C Binding Site BS01 |
|
|
Ligand ID | 9D9 |
InChI | InChI=1S/C11H15F2N4O4P/c12-11(13,22(19,20)21)4-2-1-3-6-5-15-8-7(6)16-10(14)17-9(8)18/h5,15H,1-4H2,(H2,19,20,21)(H3,14,16,17,18) |
InChIKey | OISKFAFOKMNXNK-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1c(c2c([nH]1)C(=O)NC(=N2)N)CCCCC(F)(F)P(=O)(O)O | CACTVS 3.385 | NC1=Nc2c(CCCCC(F)(F)[P](O)(O)=O)c[nH]c2C(=O)N1 | ACDLabs 12.01 | OP(O)(=O)C(CCCCc1c2c(nc1)C(NC(=N2)N)=O)(F)F |
|
Formula | C11 H15 F2 N4 O4 P |
Name | [5-(2-amino-4-oxo-4,5-dihydro-3H-pyrrolo[3,2-d]pyrimidin-7-yl)-1,1-difluoropentyl]phosphonic acid; DFPP-DG |
ChEMBL | CHEMBL236709 |
DrugBank | |
ZINC | ZINC000028823715
|
PDB chain | 3fuc Chain C Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|