Structure of PDB 3bwk Chain C Binding Site BS01 |
|
|
Ligand ID | C1P |
InChI | InChI=1S/C28H39N3O5S/c1-22(2)21-26(30-28(33)31-16-18-36-19-17-31)27(32)29-24(14-13-23-9-5-3-6-10-23)15-20-37(34,35)25-11-7-4-8-12-25/h3-12,22,24,26H,13-21H2,1-2H3,(H,29,32)(H,30,33)/t24-,26-/m0/s1 |
InChIKey | IHIAYQGDASIWGA-AHWVRZQESA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.2 | CC(C)CC(C(=O)NC(CCc1ccccc1)CCS(=O)(=O)c2ccccc2)NC(=O)N3CCOCC3 | CACTVS 3.370 | CC(C)C[CH](NC(=O)N1CCOCC1)C(=O)N[CH](CCc2ccccc2)CC[S](=O)(=O)c3ccccc3 | CACTVS 3.370 | CC(C)C[C@H](NC(=O)N1CCOCC1)C(=O)N[C@@H](CCc2ccccc2)CC[S](=O)(=O)c3ccccc3 | ACDLabs 12.01 | O=C(NC(C(=O)NC(CCc1ccccc1)CCS(=O)(=O)c2ccccc2)CC(C)C)N3CCOCC3 |
|
Formula | C28 H39 N3 O5 S |
Name | N~2~-(morpholin-4-ylcarbonyl)-N-[(3S)-1-phenyl-5-(phenylsulfonyl)pentan-3-yl]-L-leucinamide; K11017, bound form |
ChEMBL | |
DrugBank | |
ZINC | ZINC000015826671
|
PDB chain | 3bwk Chain C Residue 300
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|