Structure of PDB 2zm3 Chain C Binding Site BS01 |
|
|
Ligand ID | 575 |
InChI | InChI=1S/C21H20BrN3O2/c22-15-5-8-17-18(11-15)19(21(27)24-20(17)26)12-23-16-6-3-14(4-7-16)13-25-9-1-2-10-25/h3-8,11-12,23H,1-2,9-10,13H2,(H,24,26,27)/b19-12- |
InChIKey | JFEKAVPMVOLVTH-UNOMPAQXSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | c1cc(ccc1CN2CCCC2)N\C=C/3\c4cc(ccc4C(=O)NC3=O)Br | CACTVS 3.341 | Brc1ccc2C(=O)NC(=O)C(=CNc3ccc(CN4CCCC4)cc3)c2c1 | OpenEye OEToolkits 1.5.0 | c1cc(ccc1CN2CCCC2)NC=C3c4cc(ccc4C(=O)NC3=O)Br | ACDLabs 10.04 | Brc1ccc2c(c1)/C(C(=O)NC2=O)=C/Nc3ccc(cc3)CN4CCCC4 | CACTVS 3.341 | Brc1ccc2C(=O)NC(=O)C(=C/Nc3ccc(CN4CCCC4)cc3)\c2c1 |
|
Formula | C21 H20 Br N3 O2 |
Name | (4Z)-6-bromo-4-({[4-(pyrrolidin-1-ylmethyl)phenyl]amino}methylidene)isoquinoline-1,3(2H,4H)-dione |
ChEMBL | CHEMBL263143 |
DrugBank | DB07156 |
ZINC | ZINC000018068793
|
PDB chain | 2zm3 Chain C Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|