Structure of PDB 2wbg Chain C Binding Site BS01 |
|
|
Ligand ID | LGS |
InChI | InChI=1S/C15H28N2O5/c1-2-3-4-5-6-7-8-16-15-17-10(9-22-15)11(18)12(19)13(20)14(17)21/h10-14,18-21H,2-9H2,1H3/b16-15-/t10-,11-,12+,13-,14+/m1/s1 |
InChIKey | QJILQIWQVOAQBB-KRIYVDMXSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.6.1 | CCCCCCCC/N=C\1/N2[C@H](CO1)[C@H]([C@@H]([C@H]([C@@H]2O)O)O)O | ACDLabs 10.04 | N(=C1\OCC2N1C(O)C(O)C(O)C2O)\CCCCCCCC | CACTVS 3.352 | CCCCCCCCN=C1OC[CH]2[CH](O)[CH](O)[CH](O)[CH](O)N12 | CACTVS 3.352 | CCCCCCCCN=C1OC[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@H](O)N12 | OpenEye OEToolkits 1.6.1 | CCCCCCCCN=C1N2C(CO1)C(C(C(C2O)O)O)O |
|
Formula | C15 H28 N2 O5 |
Name | (3Z,5S,6R,7S,8R,8aR)-3-(octylimino)hexahydro[1,3]oxazolo[3,4-a]pyridine-5,6,7,8-tetrol |
ChEMBL | |
DrugBank | DB08090 |
ZINC | ZINC000053683362
|
PDB chain | 2wbg Chain C Residue 1446
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|