Structure of PDB 2qs4 Chain C Binding Site BS01 |
|
|
Ligand ID | LY5 |
InChI | InChI=1S/C16H24F2N2O4/c17-16(18)5-13(15(23)24)20(8-16)7-9-1-2-10-6-19-12(14(21)22)4-11(10)3-9/h9-13,19H,1-8H2,(H,21,22)(H,23,24)/t9-,10-,11+,12-,13-/m0/s1 |
InChIKey | OXQXJYQSWZFDBB-WJTVCTBASA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | C1C[C@H]2CN[C@@H](C[C@H]2C[C@H]1CN3CC(C[C@H]3C(=O)O)(F)F)C(=O)O | OpenEye OEToolkits 1.7.6 | C1CC2CNC(CC2CC1CN3CC(CC3C(=O)O)(F)F)C(=O)O | CACTVS 3.385 | OC(=O)[CH]1C[CH]2C[CH](CC[CH]2CN1)CN3CC(F)(F)C[CH]3C(O)=O | CACTVS 3.385 | OC(=O)[C@@H]1C[C@H]2C[C@H](CC[C@H]2CN1)CN3CC(F)(F)C[C@H]3C(O)=O | ACDLabs 12.01 | FC1(CN(C(C1)C(O)=O)CC2CC3C(CC2)CNC(C(O)=O)C3)F |
|
Formula | C16 H24 F2 N2 O4 |
Name | (3S,4aR,6S,8aR)-6-{[(2S)-2-carboxy-4,4-difluoropyrrolidin-1-yl]methyl}decahydroisoquinoline-3-carboxylic acid; LY466195 |
ChEMBL | CHEMBL1234118 |
DrugBank | |
ZINC | ZINC000003989289
|
PDB chain | 2qs4 Chain C Residue 259
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|