Structure of PDB 2bmc Chain C Binding Site BS01 |
|
|
Ligand ID | MPY |
InChI | InChI=1S/C28H31N7O2/c1-4-19-7-6-8-20(5-2)25(19)29-28(37)35-17-23-24(18-35)31-32-26(23)30-27(36)21-9-11-22(12-10-21)34-15-13-33(3)14-16-34/h6-12,17-18H,4-5,13-16H2,1-3H3,(H,29,37)/b30-26+ |
InChIKey | WUWKQGPEIAHGLN-URGPHPNLSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.5 | CCc1cccc(c1NC(=O)n2cc3c(c2)N=NC3=NC(=O)c4ccc(cc4)N5CCN(CC5)C)CC | OpenEye OEToolkits 1.7.5 | CCc1cccc(c1NC(=O)n2cc\3c(c2)N=N/C3=N/C(=O)c4ccc(cc4)N5CCN(CC5)C)CC | ACDLabs 10.04 | O=C(Nc1c(cccc1CC)CC)n5cc4c(N=N/C4=N/C(=O)c2ccc(cc2)N3CCN(C)CC3)c5 | CACTVS 3.385 | CCc1cccc(CC)c1NC(=O)n2cc3N=NC(=NC(=O)c4ccc(cc4)N5CCN(C)CC5)c3c2 |
|
Formula | C28 H31 N7 O2 |
Name | (3E)-N-(2,6-DIETHYLPHENYL)-3-{[4-(4-METHYLPIPERAZIN-1-YL)BENZOYL]IMINO}PYRROLO[3,4-C]PYRAZOLE-5(3H)-CARBOXAMIDE |
ChEMBL | |
DrugBank | |
ZINC | ZINC000033295980
|
PDB chain | 2bmc Chain C Residue 1394
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|