Structure of PDB 1ovw Chain C Binding Site BS01 |
|
|
Ligand ID | SSG |
InChI | InChI=1S/C6H12O4S2/c7-1-2-5(11)3(8)4(9)6(12)10-2/h2-9,11-12H,1H2/t2-,3-,4-,5-,6+/m1/s1 |
InChIKey | MUOMBPNNVXJUGT-UKFBFLRUSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | OC[C@H]1O[C@@H](S)[C@H](O)[C@@H](O)[C@@H]1S | OpenEye OEToolkits 1.5.0 | C([C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)S)O)O)S)O | CACTVS 3.341 | OC[CH]1O[CH](S)[CH](O)[CH](O)[CH]1S | OpenEye OEToolkits 1.5.0 | C(C1C(C(C(C(O1)S)O)O)S)O | ACDLabs 10.04 | OC1C(S)C(OC(S)C1O)CO |
|
Formula | C6 H12 O4 S2 |
Name | 1,4-dithio-beta-D-glucopyranose; 1,4-DEOXY-1,4-DITHIO-BETA-D-GLUCOPYRANOSE; 1,4-dithio-beta-D-glucose; 1,4-dithio-D-glucose; 1,4-dithio-glucose |
ChEMBL | |
DrugBank | DB03857 |
ZINC | ZINC000005830031
|
PDB chain | 1ovw Chain G Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|