Structure of PDB 1gzf Chain C Binding Site BS01 |
|
|
Ligand ID | NIR |
InChI | InChI=1S/C11H18N2O4/c1-6-8(14)9(15)11(17-6)13-4-2-3-7(5-13)10(12)16/h2-3,6-9,11,14-15H,4-5H2,1H3,(H2,12,16)/t6-,7+,8-,9-,11+/m1/s1 |
InChIKey | MYKCTORFOIHUSG-LALMQGGXSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | CC1C(C(C(O1)N2CC=CC(C2)C(=O)N)O)O | CACTVS 3.341 | C[C@H]1O[C@@H]([C@H](O)[C@@H]1O)N2CC=C[C@@H](C2)C(N)=O | ACDLabs 10.04 | O=C(N)C1C=CCN(C1)C2OC(C(O)C2O)C | OpenEye OEToolkits 1.5.0 | C[C@@H]1[C@H]([C@H](C(O1)N2CC=CC(C2)C(=O)N)O)O | CACTVS 3.341 | C[CH]1O[CH]([CH](O)[CH]1O)N2CC=C[CH](C2)C(N)=O |
|
Formula | C11 H18 N2 O4 |
Name | 3-(AMINOCARBONYL)-1-[(3R,4S,5R)-3,4-DIHYDROXY-5-METHYLTETRAHYDRO-2-FURANYL]PYRIDINIUM |
ChEMBL | |
DrugBank | |
ZINC | ZINC000058649987
|
PDB chain | 1gzf Chain C Residue 1252
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
S174 E214 |
Catalytic site (residue number reindexed from 1) |
S131 E171 |
Enzyme Commision number |
2.4.2.- |
|
|
|