Structure of PDB 7o6x Chain BBB Binding Site BS01 |
|
|
Ligand ID | V4Q |
InChI | InChI=1S/C28H24FN7O2/c1-2-38-19-10-11-23(32-16-19)27-35-34-26(36(27)24-9-4-3-7-21(24)29)17-14-18(15-17)33-28(37)20-6-5-8-22-25(20)31-13-12-30-22/h3-13,16-18H,2,14-15H2,1H3,(H,33,37)/t17-,18- |
InChIKey | ARCOJIXZDJYBCH-IYARVYRRSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CCOc1ccc(nc1)c2nnc([CH]3C[CH](C3)NC(=O)c4cccc5nccnc45)n2c6ccccc6F | CACTVS 3.385 | CCOc1ccc(nc1)c2nnc([C@@H]3C[C@H](C3)NC(=O)c4cccc5nccnc45)n2c6ccccc6F | OpenEye OEToolkits 2.0.7 | CCOc1ccc(nc1)c2nnc(n2c3ccccc3F)C4CC(C4)NC(=O)c5cccc6c5nccn6 |
|
Formula | C28 H24 F N7 O2 |
Name | N-[3-[5-(5-ethoxypyridin-2-yl)-4-(2-fluorophenyl)-1,2,4-triazol-3-yl]cyclobutyl]quinoxaline-5-carboxamide; 146282356 |
ChEMBL | CHEMBL5090849 |
DrugBank | |
ZINC |
|
PDB chain | 7o6x Chain BBB Residue 1201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|