Structure of PDB 6z1t Chain BBB Binding Site BS01 |
|
|
Ligand ID | Q55 |
InChI | InChI=1S/C21H20N6O2/c1-21(12-28)11-25-18-14(10-22)8-13(9-15(18)21)16-5-7-24-20(26-16)27-17-4-3-6-23-19(17)29-2/h3-9,25,28H,11-12H2,1-2H3,(H,24,26,27)/t21-/m0/s1 |
InChIKey | PTVSCHCHSJTBBB-NRFANRHFSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COc1ncccc1Nc2nccc(n2)c3cc(C#N)c4NC[C@@](C)(CO)c4c3 | OpenEye OEToolkits 2.0.7 | CC1(CNc2c1cc(cc2C#N)c3ccnc(n3)Nc4cccnc4OC)CO | OpenEye OEToolkits 2.0.7 | C[C@]1(CNc2c1cc(cc2C#N)c3ccnc(n3)Nc4cccnc4OC)CO | CACTVS 3.385 | COc1ncccc1Nc2nccc(n2)c3cc(C#N)c4NC[C](C)(CO)c4c3 |
|
Formula | C21 H20 N6 O2 |
Name | 4S/3694; (3~{S})-3-(hydroxymethyl)-5-[2-[(2-methoxypyridin-3-yl)amino]pyrimidin-4-yl]-3-methyl-1,2-dihydroindole-7-carbonitrile |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6z1t Chain BBB Residue 701
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
D515 |
Catalytic site (residue number reindexed from 1) |
D184 |
Enzyme Commision number |
2.7.11.25: mitogen-activated protein kinase kinase kinase. |
|
|
|