Structure of PDB 8ve0 Chain B Binding Site BS01 |
|
|
Ligand ID | 1WZ |
InChI | InChI=1S/C19H21NO3/c1-12-7-14(8-13(2)18(12)21)5-6-15-9-16(19(22)23)11-17(10-15)20(3)4/h5-11,21H,1-4H3,(H,22,23)/b6-5+ |
InChIKey | BYKHVGHURSEPRX-AATRIKPKSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | Cc1cc(cc(c1O)C)C=Cc2cc(cc(c2)N(C)C)C(=O)O | CACTVS 3.385 | CN(C)c1cc(C=Cc2cc(C)c(O)c(C)c2)cc(c1)C(O)=O | OpenEye OEToolkits 1.7.6 | Cc1cc(cc(c1O)C)/C=C/c2cc(cc(c2)N(C)C)C(=O)O | CACTVS 3.385 | CN(C)c1cc(/C=C/c2cc(C)c(O)c(C)c2)cc(c1)C(O)=O | ACDLabs 12.01 | O=C(O)c1cc(cc(N(C)C)c1)\C=C\c2cc(c(O)c(c2)C)C |
|
Formula | C19 H21 N O3 |
Name | 3-(dimethylamino)-5-[(E)-2-(4-hydroxy-3,5-dimethylphenyl)ethenyl]benzoic acid; (E)-3-(dimethylamino)-5-(4-hydroxy-3,5-dimethylstyryl)benzoic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095921081
|
PDB chain | 8ve0 Chain B Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|