Structure of PDB 8qez Chain B Binding Site BS01 |
|
|
Ligand ID | UF5 |
InChI | InChI=1S/C8H9ClN2O2S2/c9-7-3-6-8(14-7)15(12,13)10-4-11(6)5-1-2-5/h3,5,10H,1-2,4H2 |
InChIKey | PJOUJJTUKBFKPV-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Clc1sc2c(c1)N(CN[S]2(=O)=O)C3CC3 | OpenEye OEToolkits 2.0.7 | c1c2c(sc1Cl)S(=O)(=O)NCN2C3CC3 |
|
Formula | C8 H9 Cl N2 O2 S2 |
Name | 6-chloranyl-4-cyclopropyl-2,3-dihydrothieno[3,2-e][1,2,4]thiadiazine 1,1-dioxide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 8qez Chain A Residue 310
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|