Structure of PDB 8q71 Chain B Binding Site BS01 |
|
|
Ligand ID | KKO |
InChI | InChI=1S/C23H22Cl2N4O3S/c1-32-21-6-7-26-13-17(21)23(31)28-8-9-29(15-4-5-18(24)19(25)11-15)20(14-28)22(30)27-12-16-3-2-10-33-16/h2-7,10-11,13,20H,8-9,12,14H2,1H3,(H,27,30)/t20-/m0/s1 |
InChIKey | XAKMNISRDIXWHA-FQEVSTJZSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | COc1ccncc1C(=O)N2CCN([C@@H](C2)C(=O)NCc3cccs3)c4ccc(c(c4)Cl)Cl | OpenEye OEToolkits 2.0.7 | COc1ccncc1C(=O)N2CCN(C(C2)C(=O)NCc3cccs3)c4ccc(c(c4)Cl)Cl | CACTVS 3.385 | COc1ccncc1C(=O)N2CCN([CH](C2)C(=O)NCc3sccc3)c4ccc(Cl)c(Cl)c4 | CACTVS 3.385 | COc1ccncc1C(=O)N2CCN([C@@H](C2)C(=O)NCc3sccc3)c4ccc(Cl)c(Cl)c4 |
|
Formula | C23 H22 Cl2 N4 O3 S |
Name | (2~{S})-1-(3,4-dichlorophenyl)-4-(4-methoxypyridin-3-yl)carbonyl-~{N}-(thiophen-2-ylmethyl)piperazine-2-carboxamide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 8q71 Chain B Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|