Structure of PDB 8j7l Chain B Binding Site BS01 |
|
|
Ligand ID | RXF |
InChI | InChI=1S/C15H18N6O6S/c1-4-27-15-19-12(16-2)17-13(20-15)18-14(23)21-28(24,25)10-8-6-5-7-9(10)11(22)26-3/h5-8H,4H2,1-3H3,(H3,16,17,18,19,20,21,23) |
InChIKey | ZINJLDJMHCUBIP-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CCOc1nc(nc(n1)NC(=O)NS(=O)(=O)c2ccccc2C(=O)OC)NC | CACTVS 3.385 | CCOc1nc(NC)nc(NC(=O)N[S](=O)(=O)c2ccccc2C(=O)OC)n1 |
|
Formula | C15 H18 N6 O6 S |
Name | methyl 2-[[4-ethoxy-6-(methylamino)-1,3,5-triazin-2-yl]carbamoylsulfamoyl]benzoate; Ethametsulfuron methyl |
ChEMBL | CHEMBL1885280 |
DrugBank | |
ZINC | ZINC000002566361
|
PDB chain | 8j7l Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|