Structure of PDB 8gtv Chain B Binding Site BS01 |
|
|
Ligand ID | KAE |
InChI | InChI=1S/C25H26Cl2N4O3/c26-21-6-5-17(13-22(21)27)30-7-8-31(18(16-30)15-29-9-11-34-12-10-29)25(33)20-14-24(32)28-23-4-2-1-3-19(20)23/h1-6,13-14,18H,7-12,15-16H2,(H,28,32)/t18-/m0/s1 |
InChIKey | LBLGMVCPRZTJIF-SFHVURJKSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Clc1ccc(cc1Cl)N2CCN([CH](CN3CCOCC3)C2)C(=O)C4=CC(=O)Nc5ccccc45 | OpenEye OEToolkits 2.0.7 | c1ccc2c(c1)C(=CC(=O)N2)C(=O)N3CCN(CC3CN4CCOCC4)c5ccc(c(c5)Cl)Cl | OpenEye OEToolkits 2.0.7 | c1ccc2c(c1)C(=CC(=O)N2)C(=O)N3CCN(C[C@@H]3CN4CCOCC4)c5ccc(c(c5)Cl)Cl | CACTVS 3.385 | Clc1ccc(cc1Cl)N2CCN([C@@H](CN3CCOCC3)C2)C(=O)C4=CC(=O)Nc5ccccc45 |
|
Formula | C25 H26 Cl2 N4 O3 |
Name | 4-[(2~{S})-4-(3,4-dichlorophenyl)-2-(morpholin-4-ylmethyl)piperazin-1-yl]carbonyl-1~{H}-quinolin-2-one |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 8gtv Chain B Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|