Structure of PDB 8aai Chain B Binding Site BS01 |
|
|
Ligand ID | LKV |
InChI | InChI=1S/C16H20N2O4/c1-9(2)13(14(19)17-10(3)16(21)22)18-8-11-6-4-5-7-12(11)15(18)20/h4-7,9-10,13H,8H2,1-3H3,(H,17,19)(H,21,22)/t10-,13-/m0/s1 |
InChIKey | ZLJCDMXBPPBVSF-GWCFXTLKSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC(C)[C@H](N1Cc2ccccc2C1=O)C(=O)N[C@@H](C)C(O)=O | OpenEye OEToolkits 2.0.7 | CC(C)C(C(=O)NC(C)C(=O)O)N1Cc2ccccc2C1=O | OpenEye OEToolkits 2.0.7 | C[C@@H](C(=O)O)NC(=O)[C@H](C(C)C)N1Cc2ccccc2C1=O | CACTVS 3.385 | CC(C)[CH](N1Cc2ccccc2C1=O)C(=O)N[CH](C)C(O)=O |
|
Formula | C16 H20 N2 O4 |
Name | (2~{S})-2-[[(2~{S})-3-methyl-2-(3-oxidanylidene-1~{H}-isoindol-2-yl)butanoyl]amino]propanoic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 8aai Chain B Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|