Structure of PDB 7vf8 Chain B Binding Site BS01 |
|
|
Ligand ID | 7KI |
InChI | InChI=1S/C35H43N4O.Co/c1-9-20-22(11-3)30-18-32-24(13-5)26(15-7)34(38-32)40-35-27(16-8)25(14-6)33(39-35)19-31-23(12-4)21(10-2)29(37-31)17-28(20)36-30;/h17-19H,9-16H2,1-8H3;/q-1;+4/b28-17-,29-17-,30-18-,31-19-,32-18-,33-19-; |
InChIKey | OPQNUXJQUPQEGE-SMMVCMDLSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CCc1c2cc3[n+]4c(cc5c(c(c6n5[Co]47n2c(c1CC)cc8[n+]7c([o+]6)C(=C8CC)CC)CC)CC)C(=C3CC)CC | CACTVS 3.385 | CCC1=C(CC)C2=CC3=[N+]4C(=[O+]c5n6c(C=C7C(=C(CC)C8=[N+]7[Co]46[N]2C1=C8)CC)c(CC)c5CC)C(=C3CC)CC | CACTVS 3.385 | CCC1=C(CC)C2=CC3=[N@@+]4C(=[O+]c5n6c(C=C7C(=C(CC)C8=[N@+]7[Co@@]46[N@]2C1=C8)CC)c(CC)c5CC)C(=C3CC)CC |
|
Formula | C35 H43 Co N4 O |
Name | Co-5-octaethyloxaporphyrinium cation |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 7vf8 Chain B Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|