Structure of PDB 7uy0 Chain B Binding Site BS01 |
|
|
Ligand ID | VSE |
InChI | InChI=1S/C29H34N6O/c1-33-15-17-34(18-16-33)22-9-11-23(12-10-22)35-19-26(27-28(30)31-20-32-29(27)35)21-7-13-25(14-8-21)36-24-5-3-2-4-6-24/h2-8,13-14,19-20,22-23H,9-12,15-18H2,1H3,(H2,30,31,32)/t22-,23- |
InChIKey | FDVSOQRNTAPCHB-YHBQERECSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CN1CCN(CC1)[C@@H]2CC[C@H](CC2)n3cc(c4ccc(Oc5ccccc5)cc4)c6c(N)ncnc36 | OpenEye OEToolkits 1.7.6 | CN1CCN(CC1)C2CCC(CC2)n3cc(c4c3ncnc4N)c5ccc(cc5)Oc6ccccc6 | ACDLabs 12.01 | O(c1ccccc1)c2ccc(cc2)c4c3c(ncnc3n(c4)C6CCC(N5CCN(CC5)C)CC6)N | CACTVS 3.370 | CN1CCN(CC1)[CH]2CC[CH](CC2)n3cc(c4ccc(Oc5ccccc5)cc4)c6c(N)ncnc36 |
|
Formula | C29 H34 N6 O |
Name | 7-[trans-4-(4-methylpiperazin-1-yl)cyclohexyl]-5-(4-phenoxyphenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
ChEMBL | CHEMBL45177 |
DrugBank | |
ZINC | ZINC000100798339
|
PDB chain | 7uy0 Chain B Residue 602
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.7.10.2: non-specific protein-tyrosine kinase. |
|
|
|