Structure of PDB 7n91 Chain B Binding Site BS01 |
|
|
Ligand ID | 1RJ |
InChI | InChI=1S/C18H18FN5O/c1-21-9-15(11-4-2-5-12(19)8-11)24-18-14-7-3-6-13(17(20)25)16(14)22-10-23-18/h2-8,10,15,21H,9H2,1H3,(H2,20,25)(H,22,23,24)/t15-/m1/s1 |
InChIKey | RBMOLIOJAWRTIV-OAHLLOKOSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | Fc1cccc(c1)C(CNC)Nc1ncnc2c1cccc2C(N)=O | CACTVS 3.385 | CNC[CH](Nc1ncnc2c(cccc12)C(N)=O)c3cccc(F)c3 | OpenEye OEToolkits 2.0.7 | CNCC(c1cccc(c1)F)Nc2c3cccc(c3ncn2)C(=O)N | OpenEye OEToolkits 2.0.7 | CNC[C@H](c1cccc(c1)F)Nc2c3cccc(c3ncn2)C(=O)N | CACTVS 3.385 | CNC[C@@H](Nc1ncnc2c(cccc12)C(N)=O)c3cccc(F)c3 |
|
Formula | C18 H18 F N5 O |
Name | 4-{[(1S)-1-(3-fluorophenyl)-2-(methylamino)ethyl]amino}quinazoline-8-carboxamide |
ChEMBL | CHEMBL3685329 |
DrugBank | |
ZINC | ZINC000114343430
|
PDB chain | 7n91 Chain B Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.7.11.1: non-specific serine/threonine protein kinase. |
|
|
|