Structure of PDB 7myr Chain B Binding Site BS01 |
|
|
Ligand ID | ZRD |
InChI | InChI=1S/C13H13FN6S2/c14-9-3-16-12(17-4-9)20-5-8-6-21-11(15)19-13(8,7-20)10-1-2-18-22-10/h1-4,8H,5-7H2,(H2,15,19)/t8-,13-/m0/s1 |
InChIKey | JTNSTOMSFFQQFP-SDBXPKJASA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | NC1=N[C@]2(CN(C[C@H]2CS1)c3ncc(F)cn3)c4sncc4 | OpenEye OEToolkits 2.0.7 | c1cnsc1[C@]23CN(C[C@H]2CSC(=N3)N)c4ncc(cn4)F | CACTVS 3.385 | NC1=N[C]2(CN(C[CH]2CS1)c3ncc(F)cn3)c4sncc4 | OpenEye OEToolkits 2.0.7 | c1cnsc1C23CN(CC2CSC(=N3)N)c4ncc(cn4)F | ACDLabs 12.01 | Fc1cnc(nc1)N1CC2(N=C(N)SCC2C1)c1ccns1 |
|
Formula | C13 H13 F N6 S2 |
Name | (4aR,7aR)-6-(5-fluoropyrimidin-2-yl)-7a-(1,2-thiazol-5-yl)-4,4a,5,6,7,7a-hexahydropyrrolo[3,4-d][1,3]thiazin-2-amine |
ChEMBL | CHEMBL3704998 |
DrugBank | |
ZINC | ZINC000169703444
|
PDB chain | 7myr Chain B Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.4.23.46: memapsin 2. |
|
|
|