Structure of PDB 7m96 Chain B Binding Site BS01 |
|
|
Ligand ID | YTD |
InChI | InChI=1S/C21H26N2O2/c1-21(2,20(25)16-7-5-4-6-8-16)22-14-15-9-11-18-17(13-15)10-12-19(24)23(18)3/h4-9,11,13,20,22,25H,10,12,14H2,1-3H3/t20-/m0/s1 |
InChIKey | QITHCLWWRWXBDJ-FQEVSTJZSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CN1C(=O)CCc2cc(CNC(C)(C)[C@@H](O)c3ccccc3)ccc12 | OpenEye OEToolkits 2.0.7 | CC(C)(C(c1ccccc1)O)NCc2ccc3c(c2)CCC(=O)N3C | OpenEye OEToolkits 2.0.7 | CC(C)([C@H](c1ccccc1)O)NCc2ccc3c(c2)CCC(=O)N3C | CACTVS 3.385 | CN1C(=O)CCc2cc(CNC(C)(C)[CH](O)c3ccccc3)ccc12 | ACDLabs 12.01 | CC(C)(NCc1ccc2c(CCC(=O)N2C)c1)C(O)c1ccccc1 |
|
Formula | C21 H26 N2 O2 |
Name | 6-({[(1S)-1-hydroxy-2-methyl-1-phenylpropan-2-yl]amino}methyl)-1-methyl-3,4-dihydroquinolin-2(1H)-one |
ChEMBL | CHEMBL5273358 |
DrugBank | |
ZINC |
|
PDB chain | 7m96 Chain B Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|